About dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate
dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate (PubChem CID 71021815) has the molecular formula C13H16O6
and a molecular weight of 268.26 g/mol. Its IUPAC name is dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate |
| PubChem CID | 71021815 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate |
| SMILES | COC(=O)/C(O)=C(/OCC1=CCCC=C1)C(=O)OC |
| InChI | InChI=1S/C13H16O6/c1-17-12(15)10(14)11(13(16)18-2)19-8-9-6-4-3-5-7-9/h4,6-7,14H,3,5,8H2,1-2H3/b11-10- |
| InChIKey | DYXLEAQBDKUTJE-KHPPLWFESA-N |
| XLogP | 1.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate?
The IUPAC name of dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate (CID 71021815) is dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate.
What is the SMILES notation for dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate?
The canonical SMILES for dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate is COC(=O)/C(O)=C(/OCC1=CCCC=C1)C(=O)OC.
What is the InChIKey of dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate?
The InChIKey is DYXLEAQBDKUTJE-KHPPLWFESA-N. The full InChI is InChI=1S/C13H16O6/c1-17-12(15)10(14)11(13(16)18-2)19-8-9-6-4-3-5-7-9/h4,6-7,14H,3,5,8H2,1-2H3/b11-10-.
What are the key properties of dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate?
dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate has a molecular weight of 268.26 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-2-(cyclohexa-1,5-dien-1-ylmethoxy)-3-hydroxybut-2-enedioate is sourced from PubChem (CID 71021815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).