About 2,4,7-trimethyl-1,10-phenanthroline
2,4,7-trimethyl-1,10-phenanthroline (PubChem CID 71021965) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2,4,7-trimethyl-1,10-phenanthroline.
Molecular Properties
| Compound Name | 2,4,7-trimethyl-1,10-phenanthroline |
| PubChem CID | 71021965 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2,4,7-trimethyl-1,10-phenanthroline |
| SMILES | Cc1cc(C)c2ccc3c(C)ccnc3c2n1 |
| InChI | InChI=1S/C15H14N2/c1-9-6-7-16-14-12(9)4-5-13-10(2)8-11(3)17-15(13)14/h4-8H,1-3H3 |
| InChIKey | RWHMFNNPBWGBTM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,4,7-trimethyl-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,7-trimethyl-1,10-phenanthroline?
The IUPAC name of 2,4,7-trimethyl-1,10-phenanthroline (CID 71021965) is 2,4,7-trimethyl-1,10-phenanthroline.
What is the SMILES notation for 2,4,7-trimethyl-1,10-phenanthroline?
The canonical SMILES for 2,4,7-trimethyl-1,10-phenanthroline is Cc1cc(C)c2ccc3c(C)ccnc3c2n1.
What is the InChIKey of 2,4,7-trimethyl-1,10-phenanthroline?
The InChIKey is RWHMFNNPBWGBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2/c1-9-6-7-16-14-12(9)4-5-13-10(2)8-11(3)17-15(13)14/h4-8H,1-3H3.
What are the key properties of 2,4,7-trimethyl-1,10-phenanthroline?
2,4,7-trimethyl-1,10-phenanthroline has a molecular weight of 222.29 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,7-trimethyl-1,10-phenanthroline is sourced from PubChem (CID 71021965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).