C8H14N2S2 — CID 71022290
6-methylsulfanyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine (PubChem CID 71022290) has the molecular formula C8H14N2S2 and a molecular weight of 202.35 g/mol. Its IUPAC name is 6-methylsulfanyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine.
| Compound Name | 6-methylsulfanyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 71022290 |
| Molecular Formula | C8H14N2S2 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 6-methylsulfanyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-2-amine |
| SMILES | CSC1CCC2=C(C1)SC(N)N2 |
| InChI | InChI=1S/C8H14N2S2/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h5,8,10H,2-4,9H2,1H3 |
| InChIKey | URJFIENXHJLNJZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |