About 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline
8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline (PubChem CID 71022478) has the molecular formula C13H13F4N
and a molecular weight of 259.25 g/mol. Its IUPAC name is 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline.
Molecular Properties
| Compound Name | 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline |
| PubChem CID | 71022478 |
| Molecular Formula | C13H13F4N |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline |
| SMILES | CC1=CC(C(F)(F)F)=NC2C(CF)=CC=CC12C |
| InChI | InChI=1S/C13H13F4N/c1-8-6-10(13(15,16)17)18-11-9(7-14)4-3-5-12(8,11)2/h3-6,11H,7H2,1-2H3 |
| InChIKey | VWFBBTDGTMVEPI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline?
The IUPAC name of 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline (CID 71022478) is 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline.
What is the SMILES notation for 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline?
The canonical SMILES for 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline is CC1=CC(C(F)(F)F)=NC2C(CF)=CC=CC12C.
What is the InChIKey of 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline?
The InChIKey is VWFBBTDGTMVEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F4N/c1-8-6-10(13(15,16)17)18-11-9(7-14)4-3-5-12(8,11)2/h3-6,11H,7H2,1-2H3.
What are the key properties of 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline?
8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline has a molecular weight of 259.25 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(fluoromethyl)-4,4a-dimethyl-2-(trifluoromethyl)-8aH-quinoline is sourced from PubChem (CID 71022478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).