C25H26ClN3O6S — CID 71022576
amino 4-[2-[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]ethoxy]benzoate (PubChem CID 71022576) has the molecular formula C25H26ClN3O6S and a molecular weight of 532.02 g/mol. Its IUPAC name is amino 4-[2-[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]ethoxy]benzoate.
| Compound Name | amino 4-[2-[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]ethoxy]benzoate |
|---|---|
| PubChem CID | 71022576 |
| Molecular Formula | C25H26ClN3O6S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | amino 4-[2-[[2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]ethoxy]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCOc2ccc(C(=O)ON)cc2)c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C25H26ClN3O6S/c1-17-6-12-21(13-7-17)36(32,33)29(23-5-3-4-22(26)18(23)2)16-24(30)28-14-15-34-20-10-8-19(9-11-20)25(31)35-27/h3-13H,14-16,27H2,1-2H3,(H,28,30) |
| InChIKey | RFJJHHROFCUENG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|