About 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole
5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole (PubChem CID 71022592) has the molecular formula C10H8ClI2NS
and a molecular weight of 463.51 g/mol. Its IUPAC name is 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole |
| PubChem CID | 71022592 |
| Molecular Formula | C10H8ClI2NS |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 462.82 |
| IUPAC Name | 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole |
| SMILES | Cc1c(Cl)ccc2sc(C(C)(I)I)nc12 |
| InChI | InChI=1S/C10H8ClI2NS/c1-5-6(11)3-4-7-8(5)14-9(15-7)10(2,12)13/h3-4H,1-2H3 |
| InChIKey | CEMJYIIORISGLG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole?
The IUPAC name of 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole (CID 71022592) is 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole.
What is the SMILES notation for 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole?
The canonical SMILES for 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole is Cc1c(Cl)ccc2sc(C(C)(I)I)nc12.
What is the InChIKey of 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole?
The InChIKey is CEMJYIIORISGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClI2NS/c1-5-6(11)3-4-7-8(5)14-9(15-7)10(2,12)13/h3-4H,1-2H3.
What are the key properties of 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole?
5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole has a molecular weight of 463.51 g/mol, XLogP of 5.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(1,1-diiodoethyl)-4-methyl-1,3-benzothiazole is sourced from PubChem (CID 71022592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).