About CID 71023080
CID 71023080 (PubChem CID 71023080) has the molecular formula C25H25Cl2FN4O3
and a molecular weight of 519.40 g/mol.
Molecular Properties
| Compound Name | CID 71023080 |
| PubChem CID | 71023080 |
| Molecular Formula | C25H25Cl2FN4O3 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | — |
| SMILES | CNC(=O)[C@@H]1NC2(CCN(C(C)=O)CC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C25H25Cl2FN4O3/c1-13(33)32-10-8-24(9-11-32)25(16-7-6-14(26)12-18(16)30-23(25)35)19(21(31-24)22(34)29-2)15-4-3-5-17(27)20(15)28/h3-7,12,19,21,31H,8-11H2,1-2H3,(H,29,34)(H,30,35)/t19-,21+,25+/m0/s1 |
| InChIKey | REHJJNQNQSNLAN-PIBDYAPNSA-N |
| XLogP | 3.21 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 71023080 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71023080?
The IUPAC name of CID 71023080 (CID 71023080) is not available.
What is the SMILES notation for CID 71023080?
The canonical SMILES for CID 71023080 is CNC(=O)[C@@H]1NC2(CCN(C(C)=O)CC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F.
What is the InChIKey of CID 71023080?
The InChIKey is REHJJNQNQSNLAN-PIBDYAPNSA-N. The full InChI is InChI=1S/C25H25Cl2FN4O3/c1-13(33)32-10-8-24(9-11-32)25(16-7-6-14(26)12-18(16)30-23(25)35)19(21(31-24)22(34)29-2)15-4-3-5-17(27)20(15)28/h3-7,12,19,21,31H,8-11H2,1-2H3,(H,29,34)(H,30,35)/t19-,21+,25+/m0/s1.
What are the key properties of CID 71023080?
CID 71023080 has a molecular weight of 519.40 g/mol, XLogP of 3.21, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71023080 is sourced from PubChem (CID 71023080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).