About CID 71023130
CID 71023130 (PubChem CID 71023130) has the molecular formula C28H30Cl2FN3O4
and a molecular weight of 562.47 g/mol.
Molecular Properties
| Compound Name | CID 71023130 |
| PubChem CID | 71023130 |
| Molecular Formula | C28H30Cl2FN3O4 |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | — |
| SMILES | O=C(NC1CCC(O)CC1)[C@@H]1NC2(CCOCC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C28H30Cl2FN3O4/c29-15-4-9-19-21(14-15)33-26(37)28(19)22(18-2-1-3-20(30)23(18)31)24(34-27(28)10-12-38-13-11-27)25(36)32-16-5-7-17(35)8-6-16/h1-4,9,14,16-17,22,24,34-35H,5-8,10-13H2,(H,32,36)(H,33,37)/t16?,17?,22-,24+,28+/m0/s1 |
| InChIKey | PIRIGUPRWKOENE-NVCNRFTOSA-N |
| XLogP | 4.05 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 71023130 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71023130?
The IUPAC name of CID 71023130 (CID 71023130) is not available.
What is the SMILES notation for CID 71023130?
The canonical SMILES for CID 71023130 is O=C(NC1CCC(O)CC1)[C@@H]1NC2(CCOCC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F.
What is the InChIKey of CID 71023130?
The InChIKey is PIRIGUPRWKOENE-NVCNRFTOSA-N. The full InChI is InChI=1S/C28H30Cl2FN3O4/c29-15-4-9-19-21(14-15)33-26(37)28(19)22(18-2-1-3-20(30)23(18)31)24(34-27(28)10-12-38-13-11-27)25(36)32-16-5-7-17(35)8-6-16/h1-4,9,14,16-17,22,24,34-35H,5-8,10-13H2,(H,32,36)(H,33,37)/t16?,17?,22-,24+,28+/m0/s1.
What are the key properties of CID 71023130?
CID 71023130 has a molecular weight of 562.47 g/mol, XLogP of 4.05, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71023130 is sourced from PubChem (CID 71023130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).