C28H33Cl2FN4O3 — CID 71023185
(2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5',5'-diethyl-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 71023185) has the molecular formula C28H33Cl2FN4O3 and a molecular weight of 563.50 g/mol. Its IUPAC name is (2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5',5'-diethyl-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5',5'-diethyl-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 71023185 |
| Molecular Formula | C28H33Cl2FN4O3 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | (2'R,3R,3'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5',5'-diethyl-N-(2-morpholin-4-ylethyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CCC1(CC)N[C@@H](C(=O)NCCN2CCOCC2)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C28H33Cl2FN4O3/c1-3-27(4-2)28(19-9-8-17(29)16-21(19)33-26(28)37)22(18-6-5-7-20(30)23(18)31)24(34-27)25(36)32-10-11-35-12-14-38-15-13-35/h5-9,16,22,24,34H,3-4,10-15H2,1-2H3,(H,32,36)(H,33,37)/t22-,24+,28+/m0/s1 |
| InChIKey | ORGYNUKDWVRYBJ-ZQIDGUAPSA-N |
| XLogP | 4.09 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |