C41H29N3OS — CID 71023307
4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-7,7-dimethyl-13-oxa-5-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8(20),9,11,14,16,18-octaene (PubChem CID 71023307) has the molecular formula C41H29N3OS and a molecular weight of 611.77 g/mol. Its IUPAC name is 4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-7,7-dimethyl-13-oxa-5-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8(20),9,11,14,16,18-octaene.
| Compound Name | 4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-7,7-dimethyl-13-oxa-5-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8(20),9,11,14,16,18-octaene |
|---|---|
| PubChem CID | 71023307 |
| Molecular Formula | C41H29N3OS |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-7,7-dimethyl-13-oxa-5-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),3,8(20),9,11,14,16,18-octaene |
| SMILES | CC1(C)c2cccc3c2N(c2ccccc2O3)c2cc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)sc21 |
| InChI | InChI=1S/C41H29N3OS/c1-41(2)30-19-12-22-36-38(30)44(33-20-9-10-21-35(33)45-36)34-25-37(46-39(34)41)28-17-11-18-29(23-28)40-42-31(26-13-5-3-6-14-26)24-32(43-40)27-15-7-4-8-16-27/h3-25H,1-2H3 |
| InChIKey | ITLMDMWOOKTCMS-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |