C23H23N5O2S — CID 71023318
2-(2,3-dihydrothiophen-2-yl)-1-[2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]ethanone (PubChem CID 71023318) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-(2,3-dihydrothiophen-2-yl)-1-[2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]ethanone.
| Compound Name | 2-(2,3-dihydrothiophen-2-yl)-1-[2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]ethanone |
|---|---|
| PubChem CID | 71023318 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-(2,3-dihydrothiophen-2-yl)-1-[2-(1H-indol-4-yl)-6a,7,9,10-tetrahydro-6H-[1,4]oxazino[3,4-h]pteridin-5-yl]ethanone |
| SMILES | O=C(CC1CC=CS1)N1CC2COCCN2c2nc(-c3cccc4[nH]ccc34)ncc21 |
| InChI | InChI=1S/C23H23N5O2S/c29-21(11-16-3-2-10-31-16)28-13-15-14-30-9-8-27(15)23-20(28)12-25-22(26-23)18-4-1-5-19-17(18)6-7-24-19/h1-2,4-7,10,12,15-16,24H,3,8-9,11,13-14H2 |
| InChIKey | UFUGOYKDLYTQHY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |