About 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol
3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol (PubChem CID 71023522) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol.
Molecular Properties
| Compound Name | 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol |
| PubChem CID | 71023522 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol |
| SMILES | CCCCOC1=CC(OCCCC)C(C)OC1O |
| InChI | InChI=1S/C14H26O4/c1-4-6-8-16-12-10-13(17-9-7-5-2)14(15)18-11(12)3/h10-12,14-15H,4-9H2,1-3H3 |
| InChIKey | BZZOLRKIIOHWNK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol?
The IUPAC name of 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol (CID 71023522) is 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol.
What is the SMILES notation for 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol?
The canonical SMILES for 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol is CCCCOC1=CC(OCCCC)C(C)OC1O.
What is the InChIKey of 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol?
The InChIKey is BZZOLRKIIOHWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-4-6-8-16-12-10-13(17-9-7-5-2)14(15)18-11(12)3/h10-12,14-15H,4-9H2,1-3H3.
What are the key properties of 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol?
3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol has a molecular weight of 258.36 g/mol, XLogP of 2.61, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibutoxy-2-methyl-3,6-dihydro-2H-pyran-6-ol is sourced from PubChem (CID 71023522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).