C11H17N5S — CID 71023710
7-[(3R)-3-aminopiperidin-1-yl]-1,3,5,6-tetrahydroimidazo[4,5-b]pyridine-2-thione (PubChem CID 71023710) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 7-[(3R)-3-aminopiperidin-1-yl]-1,3,5,6-tetrahydroimidazo[4,5-b]pyridine-2-thione.
| Compound Name | 7-[(3R)-3-aminopiperidin-1-yl]-1,3,5,6-tetrahydroimidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 71023710 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 7-[(3R)-3-aminopiperidin-1-yl]-1,3,5,6-tetrahydroimidazo[4,5-b]pyridine-2-thione |
| SMILES | N[C@@H]1CCCN(C2=c3[nH]c(=S)[nH]c3=NCC2)C1 |
| InChI | InChI=1S/C11H17N5S/c12-7-2-1-5-16(6-7)8-3-4-13-10-9(8)14-11(17)15-10/h7H,1-6,12H2,(H2,13,14,15,17)/t7-/m1/s1 |
| InChIKey | QJFUYNXQFPYAQK-SSDOTTSWSA-N |
| XLogP | -0.37 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|