About ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate
ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate (PubChem CID 71024254) has the molecular formula C23H19ClF3NO2
and a molecular weight of 433.86 g/mol. Its IUPAC name is ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate |
| PubChem CID | 71024254 |
| Molecular Formula | C23H19ClF3NO2 |
| Molecular Weight | 433.86 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(Cc2cc(Cl)ccc2CCc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C23H19ClF3NO2/c1-2-30-23(29)20-5-3-4-18(28-20)13-16-12-17(24)10-8-14(16)6-7-15-9-11-19(25)22(27)21(15)26/h3-5,8-12H,2,6-7,13H2,1H3 |
| InChIKey | SMERVVSARZPPRL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate?
The IUPAC name of ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate (CID 71024254) is ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate.
What is the SMILES notation for ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate?
The canonical SMILES for ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate is CCOC(=O)c1cccc(Cc2cc(Cl)ccc2CCc2ccc(F)c(F)c2F)n1.
What is the InChIKey of ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate?
The InChIKey is SMERVVSARZPPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClF3NO2/c1-2-30-23(29)20-5-3-4-18(28-20)13-16-12-17(24)10-8-14(16)6-7-15-9-11-19(25)22(27)21(15)26/h3-5,8-12H,2,6-7,13H2,1H3.
What are the key properties of ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate?
ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate has a molecular weight of 433.86 g/mol, XLogP of 5.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[[5-chloro-2-[2-(2,3,4-trifluorophenyl)ethyl]phenyl]methyl]pyridine-2-carboxylate is sourced from PubChem (CID 71024254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).