About 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one
2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one (PubChem CID 71025021) has the molecular formula C9H16O6
and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one.
Molecular Properties
| Compound Name | 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one |
| PubChem CID | 71025021 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one |
| SMILES | CCOC1(C(C)O)OCC(=O)C(CO)O1 |
| InChI | InChI=1S/C9H16O6/c1-3-13-9(6(2)11)14-5-7(12)8(4-10)15-9/h6,8,10-11H,3-5H2,1-2H3 |
| InChIKey | XAKIMLOHSKIVPD-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one?
The IUPAC name of 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one (CID 71025021) is 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one.
What is the SMILES notation for 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one?
The canonical SMILES for 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one is CCOC1(C(C)O)OCC(=O)C(CO)O1.
What is the InChIKey of 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one?
The InChIKey is XAKIMLOHSKIVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O6/c1-3-13-9(6(2)11)14-5-7(12)8(4-10)15-9/h6,8,10-11H,3-5H2,1-2H3.
What are the key properties of 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one?
2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one has a molecular weight of 220.22 g/mol, XLogP of -0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2-(1-hydroxyethyl)-4-(hydroxymethyl)-1,3-dioxan-5-one is sourced from PubChem (CID 71025021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).