C31H36FN8O3S2- — CID 71025052
2-[4-[2-fluoro-4-[[4-[4-(3-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanesulfinate (PubChem CID 71025052) has the molecular formula C31H36FN8O3S2- and a molecular weight of 651.81 g/mol. Its IUPAC name is 2-[4-[2-fluoro-4-[[4-[4-(3-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanesulfinate.
| Compound Name | 2-[4-[2-fluoro-4-[[4-[4-(3-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanesulfinate |
|---|---|
| PubChem CID | 71025052 |
| Molecular Formula | C31H36FN8O3S2- |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | 2-[4-[2-fluoro-4-[[4-[4-(3-methoxyphenyl)-2-(4-methylpiperazin-1-yl)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanesulfinate |
| SMILES | COc1cccc(-c2nc(N3CCN(C)CC3)sc2-c2ccnc(Nc3ccc(N4CCN(CCS(=O)[O-])CC4)c(F)c3)n2)c1 |
| InChI | InChI=1S/C31H37FN8O3S2/c1-37-10-14-40(15-11-37)31-36-28(22-4-3-5-24(20-22)43-2)29(44-31)26-8-9-33-30(35-26)34-23-6-7-27(25(32)21-23)39-16-12-38(13-17-39)18-19-45(41)42/h3-9,20-21H,10-19H2,1-2H3,(H,41,42)(H,33,34,35)/p-1 |
| InChIKey | WCNGICLLCYEHRB-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|