About 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine
3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine (PubChem CID 71025243) has the molecular formula C7H9FIN
and a molecular weight of 253.06 g/mol. Its IUPAC name is 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 71025243 |
| Molecular Formula | C7H9FIN |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=C(I)C(N)=CC1F |
| InChI | InChI=1S/C7H9FIN/c1-4-2-6(9)7(10)3-5(4)8/h2-5H,10H2,1H3 |
| InChIKey | MITYRWXUPGDFNQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine (CID 71025243) is 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine is CC1C=C(I)C(N)=CC1F.
What is the InChIKey of 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is MITYRWXUPGDFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FIN/c1-4-2-6(9)7(10)3-5(4)8/h2-5H,10H2,1H3.
What are the key properties of 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine?
3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 253.06 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-iodo-4-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 71025243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).