C24H32N6O5 — CID 71025267
4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoic acid (PubChem CID 71025267) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 71025267 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]-3-methoxybenzoic acid |
| SMILES | CCCCOc1nc(NCCN2CCOCC2)c2ncn(Cc3ccc(C(=O)O)cc3OC)c2n1 |
| InChI | InChI=1S/C24H32N6O5/c1-3-4-11-35-24-27-21(25-7-8-29-9-12-34-13-10-29)20-22(28-24)30(16-26-20)15-18-6-5-17(23(31)32)14-19(18)33-2/h5-6,14,16H,3-4,7-13,15H2,1-2H3,(H,31,32)(H,25,27,28) |
| InChIKey | NMYOMHZKZIQCFI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|