About tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate
tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate (PubChem CID 71025658) has the molecular formula C24H45N3O3
and a molecular weight of 423.64 g/mol. Its IUPAC name is tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate |
| PubChem CID | 71025658 |
| Molecular Formula | C24H45N3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate |
| SMILES | CCCC(O)C1CNCCC12CCN(C1(C)CCN(C(=O)OC(C)(C)C)CC1)CC2 |
| InChI | InChI=1S/C24H45N3O3/c1-6-7-20(28)19-18-25-13-8-24(19)11-16-27(17-12-24)23(5)9-14-26(15-10-23)21(29)30-22(2,3)4/h19-20,25,28H,6-18H2,1-5H3 |
| InChIKey | QKFGLUWAZPTXIM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate (CID 71025658) is tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate is CCCC(O)C1CNCCC12CCN(C1(C)CCN(C(=O)OC(C)(C)C)CC1)CC2.
What is the InChIKey of tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate?
The InChIKey is QKFGLUWAZPTXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H45N3O3/c1-6-7-20(28)19-18-25-13-8-24(19)11-16-27(17-12-24)23(5)9-14-26(15-10-23)21(29)30-22(2,3)4/h19-20,25,28H,6-18H2,1-5H3.
What are the key properties of tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate?
tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate has a molecular weight of 423.64 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[11-(1-hydroxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]-4-methylpiperidine-1-carboxylate is sourced from PubChem (CID 71025658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).