C36H34FN3O4 — CID 71025874
N-[(2S)-1-[(3aR,6aS)-4-(naphthalene-1-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-4-propan-2-ylbenzamide (PubChem CID 71025874) has the molecular formula C36H34FN3O4 and a molecular weight of 591.68 g/mol. Its IUPAC name is N-[(2S)-1-[(3aR,6aS)-4-(naphthalene-1-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-4-propan-2-ylbenzamide.
| Compound Name | N-[(2S)-1-[(3aR,6aS)-4-(naphthalene-1-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 71025874 |
| Molecular Formula | C36H34FN3O4 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | N-[(2S)-1-[(3aR,6aS)-4-(naphthalene-1-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-(4-fluorophenyl)-1-oxopropan-2-yl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N2CC[C@@H]3[C@H]2C(=O)CN3C(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C36H34FN3O4/c1-22(2)24-12-14-26(15-13-24)34(42)38-30(20-23-10-16-27(37)17-11-23)36(44)39-19-18-31-33(39)32(41)21-40(31)35(43)29-9-5-7-25-6-3-4-8-28(25)29/h3-17,22,30-31,33H,18-21H2,1-2H3,(H,38,42)/t30-,31+,33-/m0/s1 |
| InChIKey | NRWNEKZAYRZWDG-PZWMIYICSA-N |
| XLogP | 5.14 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |