C20H21ClN2O2 — CID 71026249
(6aS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide (PubChem CID 71026249) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is (6aS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide.
| Compound Name | (6aS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 71026249 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (6aS)-11-chloro-12-hydroxy-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepine-4-carboxamide |
| SMILES | CN1CCc2cc(Cl)c(O)cc2C2c3cccc(C(N)=O)c3CC[C@@H]21 |
| InChI | InChI=1S/C20H21ClN2O2/c1-23-8-7-11-9-16(21)18(24)10-15(11)19-13-3-2-4-14(20(22)25)12(13)5-6-17(19)23/h2-4,9-10,17,19,24H,5-8H2,1H3,(H2,22,25)/t17-,19?/m0/s1 |
| InChIKey | QFXZVYPKIACEJD-KKFHFHRHSA-N |
| XLogP | 3.08 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |