C19H19BrClNO — CID 71026253
(6aS)-2-bromo-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol (PubChem CID 71026253) has the molecular formula C19H19BrClNO and a molecular weight of 392.72 g/mol. Its IUPAC name is (6aS)-2-bromo-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol.
| Compound Name | (6aS)-2-bromo-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol |
|---|---|
| PubChem CID | 71026253 |
| Molecular Formula | C19H19BrClNO |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | (6aS)-2-bromo-11-chloro-7-methyl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol |
| SMILES | CN1CCc2cc(Cl)c(O)cc2C2c3cc(Br)ccc3CC[C@@H]21 |
| InChI | InChI=1S/C19H19BrClNO/c1-22-7-6-12-8-16(21)18(23)10-15(12)19-14-9-13(20)4-2-11(14)3-5-17(19)22/h2,4,8-10,17,19,23H,3,5-7H2,1H3/t17-,19?/m0/s1 |
| InChIKey | MJYXWRPBCQQINT-KKFHFHRHSA-N |
| XLogP | 4.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |