C16H19NO — CID 71026441
3-ethyl-1-phenyl-3a,4,5,7a-tetrahydroindol-2-ol (PubChem CID 71026441) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-ethyl-1-phenyl-3a,4,5,7a-tetrahydroindol-2-ol.
| Compound Name | 3-ethyl-1-phenyl-3a,4,5,7a-tetrahydroindol-2-ol |
|---|---|
| PubChem CID | 71026441 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 3-ethyl-1-phenyl-3a,4,5,7a-tetrahydroindol-2-ol |
| SMILES | CCC1=C(O)N(c2ccccc2)C2C=CCCC12 |
| InChI | InChI=1S/C16H19NO/c1-2-13-14-10-6-7-11-15(14)17(16(13)18)12-8-4-3-5-9-12/h3-5,7-9,11,14-15,18H,2,6,10H2,1H3 |
| InChIKey | UCDOJAAINZMXEX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|