C12H24N2O — CID 71026500
(1S,2R,3R)-5-methyl-3-pentan-3-yloxycyclohex-4-ene-1,2-diamine (PubChem CID 71026500) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (1S,2R,3R)-5-methyl-3-pentan-3-yloxycyclohex-4-ene-1,2-diamine.
| Compound Name | (1S,2R,3R)-5-methyl-3-pentan-3-yloxycyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 71026500 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (1S,2R,3R)-5-methyl-3-pentan-3-yloxycyclohex-4-ene-1,2-diamine |
| SMILES | CCC(CC)O[C@@H]1C=C(C)C[C@H](N)[C@H]1N |
| InChI | InChI=1S/C12H24N2O/c1-4-9(5-2)15-11-7-8(3)6-10(13)12(11)14/h7,9-12H,4-6,13-14H2,1-3H3/t10-,11+,12+/m0/s1 |
| InChIKey | FBQBDXBMEWRMKU-QJPTWQEYSA-N |
| XLogP | 1.56 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|