C23H32N2O4 — CID 71026610
2-[ethyl-[9-methyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carbonyl]amino]acetic acid (PubChem CID 71026610) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[ethyl-[9-methyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[9-methyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 71026610 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-[ethyl-[9-methyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carbonyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)c1ccc2c(c1)C1CC(C3CCOCC3)CCC1N2C |
| InChI | InChI=1S/C23H32N2O4/c1-3-25(14-22(26)27)23(28)17-5-7-21-19(13-17)18-12-16(4-6-20(18)24(21)2)15-8-10-29-11-9-15/h5,7,13,15-16,18,20H,3-4,6,8-12,14H2,1-2H3,(H,26,27) |
| InChIKey | WAGIWNOKKUZDIN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |