C20H27NO3 — CID 71026650
(6R)-9-ethyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid (PubChem CID 71026650) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (6R)-9-ethyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid.
| Compound Name | (6R)-9-ethyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 71026650 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (6R)-9-ethyl-6-(oxan-4-yl)-4b,5,6,7,8,8a-hexahydrocarbazole-3-carboxylic acid |
| SMILES | CCN1c2ccc(C(=O)O)cc2C2C[C@H](C3CCOCC3)CCC21 |
| InChI | InChI=1S/C20H27NO3/c1-2-21-18-5-3-14(13-7-9-24-10-8-13)11-16(18)17-12-15(20(22)23)4-6-19(17)21/h4,6,12-14,16,18H,2-3,5,7-11H2,1H3,(H,22,23)/t14-,16?,18?/m1/s1 |
| InChIKey | ZBVOUZKPSNAPNW-MXWWQKGMSA-N |
| XLogP | 3.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |