About 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine
4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine (PubChem CID 71026734) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine |
| PubChem CID | 71026734 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine |
| SMILES | CC1=CC=C(C2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C15H25N/c1-12(2)16-10-8-15(9-11-16)14-6-4-13(3)5-7-14/h4,6,12,15H,5,7-11H2,1-3H3 |
| InChIKey | BHIPCFSJPJZRAD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine?
The IUPAC name of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine (CID 71026734) is 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine.
What is the SMILES notation for 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine?
The canonical SMILES for 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine is CC1=CC=C(C2CCN(C(C)C)CC2)CC1.
What is the InChIKey of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine?
The InChIKey is BHIPCFSJPJZRAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-12(2)16-10-8-15(9-11-16)14-6-4-13(3)5-7-14/h4,6,12,15H,5,7-11H2,1-3H3.
What are the key properties of 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine?
4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine has a molecular weight of 219.37 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylcyclohexa-1,3-dien-1-yl)-1-propan-2-ylpiperidine is sourced from PubChem (CID 71026734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).