About 5-iodo-2,3-dihydro-1H-indol-4-ol
5-iodo-2,3-dihydro-1H-indol-4-ol (PubChem CID 71026845) has the molecular formula C8H8INO
and a molecular weight of 261.06 g/mol. Its IUPAC name is 5-iodo-2,3-dihydro-1H-indol-4-ol.
Molecular Properties
| Compound Name | 5-iodo-2,3-dihydro-1H-indol-4-ol |
| PubChem CID | 71026845 |
| Molecular Formula | C8H8INO |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 5-iodo-2,3-dihydro-1H-indol-4-ol |
| SMILES | Oc1c(I)ccc2c1CCN2 |
| InChI | InChI=1S/C8H8INO/c9-6-1-2-7-5(8(6)11)3-4-10-7/h1-2,10-11H,3-4H2 |
| InChIKey | BGWBQOIXMSLEKE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2,3-dihydro-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2,3-dihydro-1H-indol-4-ol?
The IUPAC name of 5-iodo-2,3-dihydro-1H-indol-4-ol (CID 71026845) is 5-iodo-2,3-dihydro-1H-indol-4-ol.
What is the SMILES notation for 5-iodo-2,3-dihydro-1H-indol-4-ol?
The canonical SMILES for 5-iodo-2,3-dihydro-1H-indol-4-ol is Oc1c(I)ccc2c1CCN2.
What is the InChIKey of 5-iodo-2,3-dihydro-1H-indol-4-ol?
The InChIKey is BGWBQOIXMSLEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO/c9-6-1-2-7-5(8(6)11)3-4-10-7/h1-2,10-11H,3-4H2.
What are the key properties of 5-iodo-2,3-dihydro-1H-indol-4-ol?
5-iodo-2,3-dihydro-1H-indol-4-ol has a molecular weight of 261.06 g/mol, XLogP of 1.96, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2,3-dihydro-1H-indol-4-ol is sourced from PubChem (CID 71026845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).