C25H32N8O5 — CID 71027066
5-methyl-6-[[3,4,5-trimethoxy-N-[2-(2-methyl-5-nitro-4,5-dihydroimidazol-1-yl)ethyl]anilino]methyl]quinazoline-2,4-diamine (PubChem CID 71027066) has the molecular formula C25H32N8O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 5-methyl-6-[[3,4,5-trimethoxy-N-[2-(2-methyl-5-nitro-4,5-dihydroimidazol-1-yl)ethyl]anilino]methyl]quinazoline-2,4-diamine.
| Compound Name | 5-methyl-6-[[3,4,5-trimethoxy-N-[2-(2-methyl-5-nitro-4,5-dihydroimidazol-1-yl)ethyl]anilino]methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 71027066 |
| Molecular Formula | C25H32N8O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 5-methyl-6-[[3,4,5-trimethoxy-N-[2-(2-methyl-5-nitro-4,5-dihydroimidazol-1-yl)ethyl]anilino]methyl]quinazoline-2,4-diamine |
| SMILES | COc1cc(N(CCN2C(C)=NCC2[N+](=O)[O-])Cc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC |
| InChI | InChI=1S/C25H32N8O5/c1-14-16(6-7-18-22(14)24(26)30-25(27)29-18)13-31(8-9-32-15(2)28-12-21(32)33(34)35)17-10-19(36-3)23(38-5)20(11-17)37-4/h6-7,10-11,21H,8-9,12-13H2,1-5H3,(H4,26,27,29,30) |
| InChIKey | CPUUOCKYPQENEK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|