4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid

C9H14O5 — CID 71027320

IUPAC4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid
SMILESCC1CC(C(=O)O)C(C(=O)O)CC1O
InChIInChI=1S/C9H14O5/c1-4-2-5(8(11)12)6(9(13)14)3-7(4)10/h4-7,10H,2-3H2,1H3,(H,11,12)(H,13,14)
InChIKeyJTJQKYXYIBYAEB-UHFFFAOYSA-N
MW202.21 g/mol
LogP0.18
Rot. Bonds2

About 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid

4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid (PubChem CID 71027320) has the molecular formula C9H14O5 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid.

Molecular Properties

Compound Name4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid
PubChem CID71027320
Molecular FormulaC9H14O5
Molecular Weight202.21 g/mol
Exact Mass202.08
IUPAC Name4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid
SMILESCC1CC(C(=O)O)C(C(=O)O)CC1O
InChIInChI=1S/C9H14O5/c1-4-2-5(8(11)12)6(9(13)14)3-7(4)10/h4-7,10H,2-3H2,1H3,(H,11,12)(H,13,14)
InChIKeyJTJQKYXYIBYAEB-UHFFFAOYSA-N
XLogP0.18
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.21
LogP ≤ 50.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid?
The IUPAC name of 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid (CID 71027320) is 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid.
What is the SMILES notation for 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid?
The canonical SMILES for 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid is CC1CC(C(=O)O)C(C(=O)O)CC1O.
What is the InChIKey of 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid?
The InChIKey is JTJQKYXYIBYAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5/c1-4-2-5(8(11)12)6(9(13)14)3-7(4)10/h4-7,10H,2-3H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid?
4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid has a molecular weight of 202.21 g/mol, XLogP of 0.18, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-methylcyclohexane-1,2-dicarboxylic acid is sourced from PubChem (CID 71027320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).