C18H26N4O8 — CID 71027472
2-[4,7-bis(carboxymethyl)-5-[2-(2,5-dioxopyrrol-1-yl)ethyl]-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 71027472) has the molecular formula C18H26N4O8 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-5-[2-(2,5-dioxopyrrol-1-yl)ethyl]-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-5-[2-(2,5-dioxopyrrol-1-yl)ethyl]-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 71027472 |
| Molecular Formula | C18H26N4O8 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-5-[2-(2,5-dioxopyrrol-1-yl)ethyl]-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CC(CCN2C(=O)C=CC2=O)N(CC(=O)O)CC1 |
| InChI | InChI=1S/C18H26N4O8/c23-14-1-2-15(24)22(14)4-3-13-9-20(11-17(27)28)6-5-19(10-16(25)26)7-8-21(13)12-18(29)30/h1-2,13H,3-12H2,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | LLAVOUYDHJKNCA-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|