C25H30F3N3 — CID 71027727
(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-3-[(3R)-4-imidazol-1-yl-3-methylbutyl]-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 71027727) has the molecular formula C25H30F3N3 and a molecular weight of 429.53 g/mol. Its IUPAC name is (2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-3-[(3R)-4-imidazol-1-yl-3-methylbutyl]-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-3-[(3R)-4-imidazol-1-yl-3-methylbutyl]-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 71027727 |
| Molecular Formula | C25H30F3N3 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-3-[(3R)-4-imidazol-1-yl-3-methylbutyl]-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@H](CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1C1C=CC=CC1)Cn1ccnc1 |
| InChI | InChI=1S/C25H30F3N3/c1-17(15-31-13-12-29-16-31)8-10-21-18(2)22-14-20(25(26,27)28)9-11-23(22)30-24(21)19-6-4-3-5-7-19/h3-6,9,11-14,16-19,21,24,30H,7-8,10,15H2,1-2H3/t17-,18+,19?,21-,24+/m1/s1 |
| InChIKey | QJPZNAACOIVXFZ-ITNYCCBFSA-N |
| XLogP | 6.66 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |