C23H25N3O4 — CID 7102804
(3R)-1-(4-ethoxyphenyl)-5-oxo-N'-[(E)-4-oxo-4-phenylbut-2-en-2-yl]pyrrolidine-3-carbohydrazide (PubChem CID 7102804) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-5-oxo-N'-[(E)-4-oxo-4-phenylbut-2-en-2-yl]pyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-5-oxo-N'-[(E)-4-oxo-4-phenylbut-2-en-2-yl]pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 7102804 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-5-oxo-N'-[(E)-4-oxo-4-phenylbut-2-en-2-yl]pyrrolidine-3-carbohydrazide |
| SMILES | CCOc1ccc(N2C[C@H](C(=O)NN/C(C)=C/C(=O)c3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-3-30-20-11-9-19(10-12-20)26-15-18(14-22(26)28)23(29)25-24-16(2)13-21(27)17-7-5-4-6-8-17/h4-13,18,24H,3,14-15H2,1-2H3,(H,25,29)/b16-13+/t18-/m1/s1 |
| InChIKey | VGMJWNZEGWCGEQ-IYICPGQYSA-N |
| XLogP | 2.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|