C29H36N4O5 — CID 71028225
4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-[[(2S)-1-iminobutan-2-yl]carbamoyl]piperazine-1,4-dicarboxylate (PubChem CID 71028225) has the molecular formula C29H36N4O5 and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-[[(2S)-1-iminobutan-2-yl]carbamoyl]piperazine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-[[(2S)-1-iminobutan-2-yl]carbamoyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 71028225 |
| Molecular Formula | C29H36N4O5 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 4-O-tert-butyl 1-O-(9H-fluoren-9-ylmethyl) 2-[[(2S)-1-iminobutan-2-yl]carbamoyl]piperazine-1,4-dicarboxylate |
| SMILES | [H]/N=C/[C@H](CC)NC(=O)C1CN(C(=O)OC(C)(C)C)CCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H36N4O5/c1-5-19(16-30)31-26(34)25-17-32(27(35)38-29(2,3)4)14-15-33(25)28(36)37-18-24-22-12-8-6-10-20(22)21-11-7-9-13-23(21)24/h6-13,16,19,24-25,30H,5,14-15,17-18H2,1-4H3,(H,31,34)/b30-16+/t19-,25?/m0/s1 |
| InChIKey | NRZDZSFGDCHMKW-GBHVUERWSA-N |
| XLogP | 4.40 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|