C25H30F3N7O3 — CID 71028442
4-(2-oxo-6,7-dihydro-1H-imidazo[4,5-b]pyrazin-3-yl)-N-[(3R,6S)-2-oxo-6-phenyl-1-(2,2,2-trifluoroethyl)azepan-3-yl]piperidine-1-carboxamide (PubChem CID 71028442) has the molecular formula C25H30F3N7O3 and a molecular weight of 533.56 g/mol. Its IUPAC name is 4-(2-oxo-6,7-dihydro-1H-imidazo[4,5-b]pyrazin-3-yl)-N-[(3R,6S)-2-oxo-6-phenyl-1-(2,2,2-trifluoroethyl)azepan-3-yl]piperidine-1-carboxamide.
| Compound Name | 4-(2-oxo-6,7-dihydro-1H-imidazo[4,5-b]pyrazin-3-yl)-N-[(3R,6S)-2-oxo-6-phenyl-1-(2,2,2-trifluoroethyl)azepan-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71028442 |
| Molecular Formula | C25H30F3N7O3 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 4-(2-oxo-6,7-dihydro-1H-imidazo[4,5-b]pyrazin-3-yl)-N-[(3R,6S)-2-oxo-6-phenyl-1-(2,2,2-trifluoroethyl)azepan-3-yl]piperidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@@H](c2ccccc2)CN(CC(F)(F)F)C1=O)N1CCC(n2c3c([nH]c2=O)NCC=N3)CC1 |
| InChI | InChI=1S/C25H30F3N7O3/c26-25(27,28)15-34-14-17(16-4-2-1-3-5-16)6-7-19(22(34)36)31-23(37)33-12-8-18(9-13-33)35-21-20(32-24(35)38)29-10-11-30-21/h1-5,11,17-19,29H,6-10,12-15H2,(H,31,37)(H,32,38)/t17-,19-/m1/s1 |
| InChIKey | DYOYDAFNWVSBLD-IEBWSBKVSA-N |
| XLogP | 2.99 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |