C28H23F3N4O — CID 71028784
4-(2-pyridin-2-yl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(2,2,2-trifluoroethoxy)phenyl]quinoline (PubChem CID 71028784) has the molecular formula C28H23F3N4O and a molecular weight of 488.51 g/mol. Its IUPAC name is 4-(2-pyridin-2-yl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(2,2,2-trifluoroethoxy)phenyl]quinoline.
| Compound Name | 4-(2-pyridin-2-yl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(2,2,2-trifluoroethoxy)phenyl]quinoline |
|---|---|
| PubChem CID | 71028784 |
| Molecular Formula | C28H23F3N4O |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 4-(2-pyridin-2-yl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(2,2,2-trifluoroethoxy)phenyl]quinoline |
| SMILES | FC(F)(F)COc1ccc(-c2ccc3c(C4C(c5ccccn5)=NN5CCCC45)ccnc3c2)cc1 |
| InChI | InChI=1S/C28H23F3N4O/c29-28(30,31)17-36-20-9-6-18(7-10-20)19-8-11-21-22(12-14-33-24(21)16-19)26-25-5-3-15-35(25)34-27(26)23-4-1-2-13-32-23/h1-2,4,6-14,16,25-26H,3,5,15,17H2 |
| InChIKey | KZWLQISPJBDWRH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |