C25H28F4N2O3 — CID 71029113
7-[1-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]ethoxymethyl]-7-phenyl-1,4,5,5a,6,8,9,9a-octahydropyrido[3,2-d][1,3]oxazepin-2-one (PubChem CID 71029113) has the molecular formula C25H28F4N2O3 and a molecular weight of 480.50 g/mol. Its IUPAC name is 7-[1-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]ethoxymethyl]-7-phenyl-1,4,5,5a,6,8,9,9a-octahydropyrido[3,2-d][1,3]oxazepin-2-one.
| Compound Name | 7-[1-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]ethoxymethyl]-7-phenyl-1,4,5,5a,6,8,9,9a-octahydropyrido[3,2-d][1,3]oxazepin-2-one |
|---|---|
| PubChem CID | 71029113 |
| Molecular Formula | C25H28F4N2O3 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 7-[1-[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]ethoxymethyl]-7-phenyl-1,4,5,5a,6,8,9,9a-octahydropyrido[3,2-d][1,3]oxazepin-2-one |
| SMILES | CC(OCC1(c2ccccc2)CCC2NC(=O)OCCC2N1)c1cc(CF)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F4N2O3/c1-16(18-11-17(14-26)12-20(13-18)25(27,28)29)34-15-24(19-5-3-2-4-6-19)9-7-21-22(31-24)8-10-33-23(32)30-21/h2-6,11-13,16,21-22,31H,7-10,14-15H2,1H3,(H,30,32) |
| InChIKey | QFRIAVFLGUYJPO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |