C26H31NO3 — CID 71029510
(4S)-4-[3-cyclopentyloxy-4-(cyclopropylmethoxy)phenyl]-1-(3-methylphenyl)pyrrolidin-2-one (PubChem CID 71029510) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is (4S)-4-[3-cyclopentyloxy-4-(cyclopropylmethoxy)phenyl]-1-(3-methylphenyl)pyrrolidin-2-one.
| Compound Name | (4S)-4-[3-cyclopentyloxy-4-(cyclopropylmethoxy)phenyl]-1-(3-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 71029510 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (4S)-4-[3-cyclopentyloxy-4-(cyclopropylmethoxy)phenyl]-1-(3-methylphenyl)pyrrolidin-2-one |
| SMILES | Cc1cccc(N2C[C@H](c3ccc(OCC4CC4)c(OC4CCCC4)c3)CC2=O)c1 |
| InChI | InChI=1S/C26H31NO3/c1-18-5-4-6-22(13-18)27-16-21(15-26(27)28)20-11-12-24(29-17-19-9-10-19)25(14-20)30-23-7-2-3-8-23/h4-6,11-14,19,21,23H,2-3,7-10,15-17H2,1H3/t21-/m1/s1 |
| InChIKey | JDJQHSLVQTXLPE-OAQYLSRUSA-N |
| XLogP | 5.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |