C22H33N3O3 — CID 71030038
(3R,4S,6R)-4-(dimethylamino)-6-methyl-3-[3-[methyl(quinolin-3-ylmethyl)amino]propoxy]oxan-2-ol (PubChem CID 71030038) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (3R,4S,6R)-4-(dimethylamino)-6-methyl-3-[3-[methyl(quinolin-3-ylmethyl)amino]propoxy]oxan-2-ol.
| Compound Name | (3R,4S,6R)-4-(dimethylamino)-6-methyl-3-[3-[methyl(quinolin-3-ylmethyl)amino]propoxy]oxan-2-ol |
|---|---|
| PubChem CID | 71030038 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (3R,4S,6R)-4-(dimethylamino)-6-methyl-3-[3-[methyl(quinolin-3-ylmethyl)amino]propoxy]oxan-2-ol |
| SMILES | C[C@@H]1C[C@H](N(C)C)[C@@H](OCCCN(C)Cc2cnc3ccccc3c2)C(O)O1 |
| InChI | InChI=1S/C22H33N3O3/c1-16-12-20(24(2)3)21(22(26)28-16)27-11-7-10-25(4)15-17-13-18-8-5-6-9-19(18)23-14-17/h5-6,8-9,13-14,16,20-22,26H,7,10-12,15H2,1-4H3/t16-,20+,21-,22?/m1/s1 |
| InChIKey | LYUWENHLTZWJMA-DNGQLBEFSA-N |
| XLogP | 2.50 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|