C16H17NO7 — CID 71030064
N-[3-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-oxoethoxy]phenyl]acetamide (PubChem CID 71030064) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is N-[3-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-oxoethoxy]phenyl]acetamide.
| Compound Name | N-[3-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-oxoethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 71030064 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[3-[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-oxoethoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCC(=O)C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C16H17NO7/c1-9(18)17-10-5-4-6-11(7-10)22-8-12(19)13-14(20)23-16(2,3)24-15(13)21/h4-7,13H,8H2,1-3H3,(H,17,18) |
| InChIKey | HFMQRGUWJVNKHM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|