C28H34N6O2 — CID 71030345
(10S)-10-benzyl-6-methoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),4,6,16,19(23),20-hexaen-11-one (PubChem CID 71030345) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is (10S)-10-benzyl-6-methoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),4,6,16,19(23),20-hexaen-11-one.
| Compound Name | (10S)-10-benzyl-6-methoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),4,6,16,19(23),20-hexaen-11-one |
|---|---|
| PubChem CID | 71030345 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (10S)-10-benzyl-6-methoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),4,6,16,19(23),20-hexaen-11-one |
| SMILES | COC1=C2CC(C=C1)Nc1ncnc3[nH]cc(c13)CCCN(C)C(=O)[C@H](Cc1ccccc1)N(C)C2 |
| InChI | InChI=1S/C28H34N6O2/c1-33-13-7-10-20-16-29-26-25(20)27(31-18-30-26)32-22-11-12-24(36-3)21(15-22)17-34(2)23(28(33)35)14-19-8-5-4-6-9-19/h4-6,8-9,11-12,16,18,22-23H,7,10,13-15,17H2,1-3H3,(H2,29,30,31,32)/t22?,23-/m0/s1 |
| InChIKey | XANZWTZBMUKQAU-WCSIJFPASA-N |
| XLogP | 3.55 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |