C24H31N5O2 — CID 71030431
6-methoxy-9,14-dimethyl-2,9,14,20,22-pentazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(25),3(26),4,6,18,21,23-heptaen-13-one (PubChem CID 71030431) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 6-methoxy-9,14-dimethyl-2,9,14,20,22-pentazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(25),3(26),4,6,18,21,23-heptaen-13-one.
| Compound Name | 6-methoxy-9,14-dimethyl-2,9,14,20,22-pentazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(25),3(26),4,6,18,21,23-heptaen-13-one |
|---|---|
| PubChem CID | 71030431 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 6-methoxy-9,14-dimethyl-2,9,14,20,22-pentazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(25),3(26),4,6,18,21,23-heptaen-13-one |
| SMILES | COc1ccc2cc1CN(C)CCCC(=O)N(C)CCCc1c[nH]c3nccc(c13)N2 |
| InChI | InChI=1S/C24H31N5O2/c1-28-12-5-7-22(30)29(2)13-4-6-17-15-26-24-23(17)20(10-11-25-24)27-19-8-9-21(31-3)18(14-19)16-28/h8-11,14-15,27H,4-7,12-13,16H2,1-3H3,(H,25,26) |
| InChIKey | KDOSLSAFVUWSDE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |