C28H41N3O3 — CID 71030500
(E,4E)-N-[4-(cyclopropylamino)-4-oxobutyl]-N,2-dimethyl-4-[1-methyl-3-methylidene-5-(oxan-4-yl)-4,5,6,7-tetrahydroindol-2-ylidene]but-2-enamide (PubChem CID 71030500) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is (E,4E)-N-[4-(cyclopropylamino)-4-oxobutyl]-N,2-dimethyl-4-[1-methyl-3-methylidene-5-(oxan-4-yl)-4,5,6,7-tetrahydroindol-2-ylidene]but-2-enamide.
| Compound Name | (E,4E)-N-[4-(cyclopropylamino)-4-oxobutyl]-N,2-dimethyl-4-[1-methyl-3-methylidene-5-(oxan-4-yl)-4,5,6,7-tetrahydroindol-2-ylidene]but-2-enamide |
|---|---|
| PubChem CID | 71030500 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | (E,4E)-N-[4-(cyclopropylamino)-4-oxobutyl]-N,2-dimethyl-4-[1-methyl-3-methylidene-5-(oxan-4-yl)-4,5,6,7-tetrahydroindol-2-ylidene]but-2-enamide |
| SMILES | C=c1c2c(n(C)/c1=C/C=C(\C)C(=O)N(C)CCCC(=O)NC1CC1)CCC(C1CCOCC1)C2 |
| InChI | InChI=1S/C28H41N3O3/c1-19(28(33)30(3)15-5-6-27(32)29-23-9-10-23)7-11-25-20(2)24-18-22(8-12-26(24)31(25)4)21-13-16-34-17-14-21/h7,11,21-23H,2,5-6,8-10,12-18H2,1,3-4H3,(H,29,32)/b19-7+,25-11+ |
| InChIKey | GHDLWGMHEOLDEG-DVTLPJKQSA-N |
| XLogP | 2.21 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|