C21H34N2O — CID 71031549
(6Z,9Z,12Z)-1-imidazol-1-yloctadeca-6,9,12-trien-1-ol (PubChem CID 71031549) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is (6Z,9Z,12Z)-1-imidazol-1-yloctadeca-6,9,12-trien-1-ol.
| Compound Name | (6Z,9Z,12Z)-1-imidazol-1-yloctadeca-6,9,12-trien-1-ol |
|---|---|
| PubChem CID | 71031549 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | (6Z,9Z,12Z)-1-imidazol-1-yloctadeca-6,9,12-trien-1-ol |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(O)n1ccnc1 |
| InChI | InChI=1S/C21H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)23-19-18-22-20-23/h6-7,9-10,12-13,18-21,24H,2-5,8,11,14-17H2,1H3/b7-6-,10-9-,13-12- |
| InChIKey | ZGLSESCYTDYREP-QNEBEIHSSA-N |
| XLogP | 5.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|