About N-(1-adamantyl)-3,3-dimethylbutanethioamide
N-(1-adamantyl)-3,3-dimethylbutanethioamide (PubChem CID 7103155) has the molecular formula C16H27NS
and a molecular weight of 265.47 g/mol. Its IUPAC name is N-(1-adamantyl)-3,3-dimethylbutanethioamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-3,3-dimethylbutanethioamide |
| PubChem CID | 7103155 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-(1-adamantyl)-3,3-dimethylbutanethioamide |
| SMILES | CC(C)(C)CC(=S)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H27NS/c1-15(2,3)10-14(18)17-16-7-11-4-12(8-16)6-13(5-11)9-16/h11-13H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | GMAYVCKIXUORSU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1-adamantyl)-3,3-dimethylbutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-3,3-dimethylbutanethioamide?
The IUPAC name of N-(1-adamantyl)-3,3-dimethylbutanethioamide (CID 7103155) is N-(1-adamantyl)-3,3-dimethylbutanethioamide.
What is the SMILES notation for N-(1-adamantyl)-3,3-dimethylbutanethioamide?
The canonical SMILES for N-(1-adamantyl)-3,3-dimethylbutanethioamide is CC(C)(C)CC(=S)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-(1-adamantyl)-3,3-dimethylbutanethioamide?
The InChIKey is GMAYVCKIXUORSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NS/c1-15(2,3)10-14(18)17-16-7-11-4-12(8-16)6-13(5-11)9-16/h11-13H,4-10H2,1-3H3,(H,17,18).
What are the key properties of N-(1-adamantyl)-3,3-dimethylbutanethioamide?
N-(1-adamantyl)-3,3-dimethylbutanethioamide has a molecular weight of 265.47 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-3,3-dimethylbutanethioamide is sourced from PubChem (CID 7103155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).