About (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one
(2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one (PubChem CID 7103158) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one |
| PubChem CID | 7103158 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one |
| SMILES | C[C@H]1OC(=O)C(C(=O)C(C)(C)C)=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C14H22O4/c1-8-17-11(14(5,6)7)9(12(16)18-8)10(15)13(2,3)4/h8H,1-7H3/t8-/m1/s1 |
| InChIKey | YGHSAYIGIPJDAX-MRVPVSSYSA-N |
| XLogP | 2.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one?
The IUPAC name of (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one (CID 7103158) is (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one.
What is the SMILES notation for (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one?
The canonical SMILES for (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one is C[C@H]1OC(=O)C(C(=O)C(C)(C)C)=C(C(C)(C)C)O1.
What is the InChIKey of (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one?
The InChIKey is YGHSAYIGIPJDAX-MRVPVSSYSA-N. The full InChI is InChI=1S/C14H22O4/c1-8-17-11(14(5,6)7)9(12(16)18-8)10(15)13(2,3)4/h8H,1-7H3/t8-/m1/s1.
What are the key properties of (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one?
(2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one has a molecular weight of 254.33 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6-tert-butyl-5-(2,2-dimethylpropanoyl)-2-methyl-1,3-dioxin-4-one is sourced from PubChem (CID 7103158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).