C15H16O3 — CID 7103173
(1S,10R,11R,16R)-1-hydroxy-8-oxatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6-trien-9-one (PubChem CID 7103173) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1S,10R,11R,16R)-1-hydroxy-8-oxatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6-trien-9-one.
| Compound Name | (1S,10R,11R,16R)-1-hydroxy-8-oxatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 7103173 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (1S,10R,11R,16R)-1-hydroxy-8-oxatetracyclo[8.6.0.02,7.011,16]hexadeca-2,4,6-trien-9-one |
| SMILES | O=C1Oc2ccccc2[C@]2(O)[C@@H]3CCCC[C@H]3[C@@H]12 |
| InChI | InChI=1S/C15H16O3/c16-14-13-9-5-1-2-6-10(9)15(13,17)11-7-3-4-8-12(11)18-14/h3-4,7-10,13,17H,1-2,5-6H2/t9-,10-,13+,15-/m1/s1 |
| InChIKey | RQWNVDAJWFMNDY-FRWLMAKKSA-N |
| XLogP | 2.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|