About 4,5-dimethyl-1,3-thiazole-2-sulfonate
4,5-dimethyl-1,3-thiazole-2-sulfonate (PubChem CID 7103197) has the molecular formula C5H6NO3S2-
and a molecular weight of 192.24 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-thiazole-2-sulfonate.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-thiazole-2-sulfonate |
| PubChem CID | 7103197 |
| Molecular Formula | C5H6NO3S2- |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 4,5-dimethyl-1,3-thiazole-2-sulfonate |
| SMILES | Cc1nc(S(=O)(=O)[O-])sc1C |
| InChI | InChI=1S/C5H7NO3S2/c1-3-4(2)10-5(6-3)11(7,8)9/h1-2H3,(H,7,8,9)/p-1 |
| InChIKey | ULVRMTWURHDYGB-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-1,3-thiazole-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-thiazole-2-sulfonate?
The IUPAC name of 4,5-dimethyl-1,3-thiazole-2-sulfonate (CID 7103197) is 4,5-dimethyl-1,3-thiazole-2-sulfonate.
What is the SMILES notation for 4,5-dimethyl-1,3-thiazole-2-sulfonate?
The canonical SMILES for 4,5-dimethyl-1,3-thiazole-2-sulfonate is Cc1nc(S(=O)(=O)[O-])sc1C.
What is the InChIKey of 4,5-dimethyl-1,3-thiazole-2-sulfonate?
The InChIKey is ULVRMTWURHDYGB-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H7NO3S2/c1-3-4(2)10-5(6-3)11(7,8)9/h1-2H3,(H,7,8,9)/p-1.
What are the key properties of 4,5-dimethyl-1,3-thiazole-2-sulfonate?
4,5-dimethyl-1,3-thiazole-2-sulfonate has a molecular weight of 192.24 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-thiazole-2-sulfonate is sourced from PubChem (CID 7103197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).