C26H28ClNO2 — CID 71032233
(13S,17R)-4-chloro-17-hydroxy-17-[(4-hydroxyphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile (PubChem CID 71032233) has the molecular formula C26H28ClNO2 and a molecular weight of 421.97 g/mol. Its IUPAC name is (13S,17R)-4-chloro-17-hydroxy-17-[(4-hydroxyphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile.
| Compound Name | (13S,17R)-4-chloro-17-hydroxy-17-[(4-hydroxyphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 71032233 |
| Molecular Formula | C26H28ClNO2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (13S,17R)-4-chloro-17-hydroxy-17-[(4-hydroxyphenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3-carbonitrile |
| SMILES | C[C@]12CCC3c4ccc(C#N)c(Cl)c4CCC3C1CC[C@@]2(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C26H28ClNO2/c1-25-12-10-20-19-7-4-17(15-28)24(27)22(19)9-8-21(20)23(25)11-13-26(25,30)14-16-2-5-18(29)6-3-16/h2-7,20-21,23,29-30H,8-14H2,1H3/t20?,21?,23?,25-,26+/m0/s1 |
| InChIKey | GZMZETFMUWHQIS-IDCXVEBQSA-N |
| XLogP | 5.75 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |