About CID 71032460
CID 71032460 (PubChem CID 71032460) has the molecular formula C24H15B2Cl3
and a molecular weight of 431.37 g/mol.
Molecular Properties
| Compound Name | CID 71032460 |
| PubChem CID | 71032460 |
| Molecular Formula | C24H15B2Cl3 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | — |
| SMILES | Clc1ccc([B]c2ccc(-c3ccc([B]c4ccc(Cl)c(Cl)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H15B2Cl3/c27-22-12-9-20(10-13-22)25-18-5-1-16(2-6-18)17-3-7-19(8-4-17)26-21-11-14-23(28)24(29)15-21/h1-15H |
| InChIKey | TVVZDWOSGSICQG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71032460 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71032460?
The IUPAC name of CID 71032460 (CID 71032460) is not available.
What is the SMILES notation for CID 71032460?
The canonical SMILES for CID 71032460 is Clc1ccc([B]c2ccc(-c3ccc([B]c4ccc(Cl)c(Cl)c4)cc3)cc2)cc1.
What is the InChIKey of CID 71032460?
The InChIKey is TVVZDWOSGSICQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15B2Cl3/c27-22-12-9-20(10-13-22)25-18-5-1-16(2-6-18)17-3-7-19(8-4-17)26-21-11-14-23(28)24(29)15-21/h1-15H.
What are the key properties of CID 71032460?
CID 71032460 has a molecular weight of 431.37 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71032460 is sourced from PubChem (CID 71032460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).